C14H13ClN4O — CID 106714994
2-[(3-chlorophenyl)methyl]-5-(1-methylpyrazol-4-yl)-4H-pyrazol-3-one (PubChem CID 106714994) has the molecular formula C14H13ClN4O and a molecular weight of 288.74 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-5-(1-methylpyrazol-4-yl)-4H-pyrazol-3-one.
| Compound Name | 2-[(3-chlorophenyl)methyl]-5-(1-methylpyrazol-4-yl)-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 106714994 |
| Molecular Formula | C14H13ClN4O |
| Molecular Weight | 288.74 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-5-(1-methylpyrazol-4-yl)-4H-pyrazol-3-one |
| SMILES | Cn1cc(C2=NN(Cc3cccc(Cl)c3)C(=O)C2)cn1 |
| InChI | InChI=1S/C14H13ClN4O/c1-18-9-11(7-16-18)13-6-14(20)19(17-13)8-10-3-2-4-12(15)5-10/h2-5,7,9H,6,8H2,1H3 |
| InChIKey | BQZGIGKFIGIBLT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.74 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |