C14H17ClN4S — CID 106715370
4-chloro-2-(cyclopentylsulfanylmethyl)-6-(1-methylpyrazol-4-yl)pyrimidine (PubChem CID 106715370) has the molecular formula C14H17ClN4S and a molecular weight of 308.84 g/mol. Its IUPAC name is 4-chloro-2-(cyclopentylsulfanylmethyl)-6-(1-methylpyrazol-4-yl)pyrimidine.
| Compound Name | 4-chloro-2-(cyclopentylsulfanylmethyl)-6-(1-methylpyrazol-4-yl)pyrimidine |
|---|---|
| PubChem CID | 106715370 |
| Molecular Formula | C14H17ClN4S |
| Molecular Weight | 308.84 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 4-chloro-2-(cyclopentylsulfanylmethyl)-6-(1-methylpyrazol-4-yl)pyrimidine |
| SMILES | Cn1cc(-c2cc(Cl)nc(CSC3CCCC3)n2)cn1 |
| InChI | InChI=1S/C14H17ClN4S/c1-19-8-10(7-16-19)12-6-13(15)18-14(17-12)9-20-11-4-2-3-5-11/h6-8,11H,2-5,9H2,1H3 |
| InChIKey | FEAXKMKIJBWPJB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.84 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |