C23H42O7Si — CID 10671589
ethyl 3-[(3aR,5R,7R,7aS)-7-hydroxy-5-(2-trimethylsilylethoxymethoxy)spiro[4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-5-yl]propanoate (PubChem CID 10671589) has the molecular formula C23H42O7Si and a molecular weight of 458.67 g/mol. Its IUPAC name is ethyl 3-[(3aR,5R,7R,7aS)-7-hydroxy-5-(2-trimethylsilylethoxymethoxy)spiro[4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-5-yl]propanoate.
| Compound Name | ethyl 3-[(3aR,5R,7R,7aS)-7-hydroxy-5-(2-trimethylsilylethoxymethoxy)spiro[4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-5-yl]propanoate |
|---|---|
| PubChem CID | 10671589 |
| Molecular Formula | C23H42O7Si |
| Molecular Weight | 458.67 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | ethyl 3-[(3aR,5R,7R,7aS)-7-hydroxy-5-(2-trimethylsilylethoxymethoxy)spiro[4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-5-yl]propanoate |
| SMILES | CCOC(=O)CC[C@@]1(OCOCC[Si](C)(C)C)C[C@@H](O)[C@@H]2OC3(CCCCC3)O[C@@H]2C1 |
| InChI | InChI=1S/C23H42O7Si/c1-5-27-20(25)9-12-22(28-17-26-13-14-31(2,3)4)15-18(24)21-19(16-22)29-23(30-21)10-7-6-8-11-23/h18-19,21,24H,5-17H2,1-4H3/t18-,19-,21+,22-/m1/s1 |
| InChIKey | VAJTVKSAUKCQAJ-KRXUUXHPSA-N |
| XLogP | 4.00 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.67 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|