C21H24F3NO5S — CID 10671611
[(2S)-4-[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]amino]butan-2-yl] 4-methylbenzenesulfonate (PubChem CID 10671611) has the molecular formula C21H24F3NO5S and a molecular weight of 459.49 g/mol. Its IUPAC name is [(2S)-4-[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]amino]butan-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-4-[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]amino]butan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10671611 |
| Molecular Formula | C21H24F3NO5S |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | [(2S)-4-[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]amino]butan-2-yl] 4-methylbenzenesulfonate |
| SMILES | CO[C@@](C(=O)NCC[C@H](C)OS(=O)(=O)c1ccc(C)cc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C21H24F3NO5S/c1-15-9-11-18(12-10-15)31(27,28)30-16(2)13-14-25-19(26)20(29-3,21(22,23)24)17-7-5-4-6-8-17/h4-12,16H,13-14H2,1-3H3,(H,25,26)/t16-,20+/m0/s1 |
| InChIKey | BPWJGGIDFSWJIX-OXJNMPFZSA-N |
| XLogP | 3.70 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|