C13H20N8 — CID 106716175
[2-(4-methylpiperazin-1-yl)-6-(1-methylpyrazol-4-yl)pyrimidin-4-yl]hydrazine (PubChem CID 106716175) has the molecular formula C13H20N8 and a molecular weight of 288.36 g/mol. Its IUPAC name is [2-(4-methylpiperazin-1-yl)-6-(1-methylpyrazol-4-yl)pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(4-methylpiperazin-1-yl)-6-(1-methylpyrazol-4-yl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 106716175 |
| Molecular Formula | C13H20N8 |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | [2-(4-methylpiperazin-1-yl)-6-(1-methylpyrazol-4-yl)pyrimidin-4-yl]hydrazine |
| SMILES | CN1CCN(c2nc(NN)cc(-c3cnn(C)c3)n2)CC1 |
| InChI | InChI=1S/C13H20N8/c1-19-3-5-21(6-4-19)13-16-11(7-12(17-13)18-14)10-8-15-20(2)9-10/h7-9H,3-6,14H2,1-2H3,(H,16,17,18) |
| InChIKey | SGNHNVRWOJPIER-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 88.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|