C14H26N2O3S — CID 106717702
N-[[1-(2-tert-butylsulfonylethyl)pyrrol-2-yl]methyl]-2-methoxyethanamine (PubChem CID 106717702) has the molecular formula C14H26N2O3S and a molecular weight of 302.44 g/mol. Its IUPAC name is N-[[1-(2-tert-butylsulfonylethyl)pyrrol-2-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[1-(2-tert-butylsulfonylethyl)pyrrol-2-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 106717702 |
| Molecular Formula | C14H26N2O3S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | N-[[1-(2-tert-butylsulfonylethyl)pyrrol-2-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cccn1CCS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C14H26N2O3S/c1-14(2,3)20(17,18)11-9-16-8-5-6-13(16)12-15-7-10-19-4/h5-6,8,15H,7,9-12H2,1-4H3 |
| InChIKey | KDQVGQADSXHUQD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|