About [1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]imidazol-4-yl]methanamine
[1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]imidazol-4-yl]methanamine (PubChem CID 106718078) has the molecular formula C10H14N4S
and a molecular weight of 222.32 g/mol. Its IUPAC name is [1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]imidazol-4-yl]methanamine.
Molecular Properties
| Compound Name | [1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]imidazol-4-yl]methanamine |
| PubChem CID | 106718078 |
| Molecular Formula | C10H14N4S |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | [1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]imidazol-4-yl]methanamine |
| SMILES | Cc1nc(Cn2cnc(CN)c2)sc1C |
| InChI | InChI=1S/C10H14N4S/c1-7-8(2)15-10(13-7)5-14-4-9(3-11)12-6-14/h4,6H,3,5,11H2,1-2H3 |
| InChIKey | IPKQZYLEOXSZFC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]imidazol-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]imidazol-4-yl]methanamine?
The IUPAC name of [1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]imidazol-4-yl]methanamine (CID 106718078) is [1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]imidazol-4-yl]methanamine.
What is the SMILES notation for [1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]imidazol-4-yl]methanamine?
The canonical SMILES for [1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]imidazol-4-yl]methanamine is Cc1nc(Cn2cnc(CN)c2)sc1C.
What is the InChIKey of [1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]imidazol-4-yl]methanamine?
The InChIKey is IPKQZYLEOXSZFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4S/c1-7-8(2)15-10(13-7)5-14-4-9(3-11)12-6-14/h4,6H,3,5,11H2,1-2H3.
What are the key properties of [1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]imidazol-4-yl]methanamine?
[1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]imidazol-4-yl]methanamine has a molecular weight of 222.32 g/mol, XLogP of 1.46, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]imidazol-4-yl]methanamine is sourced from PubChem (CID 106718078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).