C27H35ClN4O — CID 10671919
1-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazin-1-yl]-2-(1-ethylpiperidin-4-yl)ethanone (PubChem CID 10671919) has the molecular formula C27H35ClN4O and a molecular weight of 467.06 g/mol. Its IUPAC name is 1-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazin-1-yl]-2-(1-ethylpiperidin-4-yl)ethanone.
| Compound Name | 1-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazin-1-yl]-2-(1-ethylpiperidin-4-yl)ethanone |
|---|---|
| PubChem CID | 10671919 |
| Molecular Formula | C27H35ClN4O |
| Molecular Weight | 467.06 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 1-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazin-1-yl]-2-(1-ethylpiperidin-4-yl)ethanone |
| SMILES | CCN1CCC(CC(=O)N2CCN(C3c4ccc(Cl)cc4CCc4cccnc43)CC2)CC1 |
| InChI | InChI=1S/C27H35ClN4O/c1-2-30-12-9-20(10-13-30)18-25(33)31-14-16-32(17-15-31)27-24-8-7-23(28)19-22(24)6-5-21-4-3-11-29-26(21)27/h3-4,7-8,11,19-20,27H,2,5-6,9-10,12-18H2,1H3 |
| InChIKey | FMNZYKRFEJMYLF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.06 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |