C14H17ClFN3 — CID 106719617
N-[[1-[(2-chloro-5-fluorophenyl)methyl]imidazol-4-yl]methyl]propan-2-amine (PubChem CID 106719617) has the molecular formula C14H17ClFN3 and a molecular weight of 281.76 g/mol. Its IUPAC name is N-[[1-[(2-chloro-5-fluorophenyl)methyl]imidazol-4-yl]methyl]propan-2-amine.
| Compound Name | N-[[1-[(2-chloro-5-fluorophenyl)methyl]imidazol-4-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 106719617 |
| Molecular Formula | C14H17ClFN3 |
| Molecular Weight | 281.76 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | N-[[1-[(2-chloro-5-fluorophenyl)methyl]imidazol-4-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1cn(Cc2cc(F)ccc2Cl)cn1 |
| InChI | InChI=1S/C14H17ClFN3/c1-10(2)17-6-13-8-19(9-18-13)7-11-5-12(16)3-4-14(11)15/h3-5,8-10,17H,6-7H2,1-2H3 |
| InChIKey | RIOSSIJSARVARG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.76 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |