C14H23N3O2 — CID 106719963
ethyl 2-[4-[(cyclopropylamino)methyl]imidazol-1-yl]pentanoate (PubChem CID 106719963) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is ethyl 2-[4-[(cyclopropylamino)methyl]imidazol-1-yl]pentanoate.
| Compound Name | ethyl 2-[4-[(cyclopropylamino)methyl]imidazol-1-yl]pentanoate |
|---|---|
| PubChem CID | 106719963 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | ethyl 2-[4-[(cyclopropylamino)methyl]imidazol-1-yl]pentanoate |
| SMILES | CCCC(C(=O)OCC)n1cnc(CNC2CC2)c1 |
| InChI | InChI=1S/C14H23N3O2/c1-3-5-13(14(18)19-4-2)17-9-12(16-10-17)8-15-11-6-7-11/h9-11,13,15H,3-8H2,1-2H3 |
| InChIKey | TZQUZWBECLCMTB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |