C14H17F2N3O — CID 106720607
N-[[1-[(3,4-difluorophenyl)methyl]imidazol-4-yl]methyl]-2-methoxyethanamine (PubChem CID 106720607) has the molecular formula C14H17F2N3O and a molecular weight of 281.31 g/mol. Its IUPAC name is N-[[1-[(3,4-difluorophenyl)methyl]imidazol-4-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[1-[(3,4-difluorophenyl)methyl]imidazol-4-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 106720607 |
| Molecular Formula | C14H17F2N3O |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | N-[[1-[(3,4-difluorophenyl)methyl]imidazol-4-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cn(Cc2ccc(F)c(F)c2)cn1 |
| InChI | InChI=1S/C14H17F2N3O/c1-20-5-4-17-7-12-9-19(10-18-12)8-11-2-3-13(15)14(16)6-11/h2-3,6,9-10,17H,4-5,7-8H2,1H3 |
| InChIKey | OTGWRPRESOROGB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|