C15H24ClNO3S — CID 106722159
N-[[3-chloro-4-(2-propan-2-ylsulfonylethoxy)phenyl]methyl]propan-1-amine (PubChem CID 106722159) has the molecular formula C15H24ClNO3S and a molecular weight of 333.88 g/mol. Its IUPAC name is N-[[3-chloro-4-(2-propan-2-ylsulfonylethoxy)phenyl]methyl]propan-1-amine.
| Compound Name | N-[[3-chloro-4-(2-propan-2-ylsulfonylethoxy)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 106722159 |
| Molecular Formula | C15H24ClNO3S |
| Molecular Weight | 333.88 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | N-[[3-chloro-4-(2-propan-2-ylsulfonylethoxy)phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(OCCS(=O)(=O)C(C)C)c(Cl)c1 |
| InChI | InChI=1S/C15H24ClNO3S/c1-4-7-17-11-13-5-6-15(14(16)10-13)20-8-9-21(18,19)12(2)3/h5-6,10,12,17H,4,7-9,11H2,1-3H3 |
| InChIKey | KJFKMJPVXDKSCP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.88 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|