C25H14F6O3 — CID 10672236
(1R,2S,3R,6S,7R,8S)-11,12-bis(trifluoromethyl)-22-oxaheptacyclo[6.6.6.32,7.13,6.02,7.09,14.015,20]tetracosa-4,9,11,13,15,17,19-heptaene-21,23-dione (PubChem CID 10672236) has the molecular formula C25H14F6O3 and a molecular weight of 476.37 g/mol. Its IUPAC name is (1R,2S,3R,6S,7R,8S)-11,12-bis(trifluoromethyl)-22-oxaheptacyclo[6.6.6.32,7.13,6.02,7.09,14.015,20]tetracosa-4,9,11,13,15,17,19-heptaene-21,23-dione.
| Compound Name | (1R,2S,3R,6S,7R,8S)-11,12-bis(trifluoromethyl)-22-oxaheptacyclo[6.6.6.32,7.13,6.02,7.09,14.015,20]tetracosa-4,9,11,13,15,17,19-heptaene-21,23-dione |
|---|---|
| PubChem CID | 10672236 |
| Molecular Formula | C25H14F6O3 |
| Molecular Weight | 476.37 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | (1R,2S,3R,6S,7R,8S)-11,12-bis(trifluoromethyl)-22-oxaheptacyclo[6.6.6.32,7.13,6.02,7.09,14.015,20]tetracosa-4,9,11,13,15,17,19-heptaene-21,23-dione |
| SMILES | O=C1OC(=O)[C@]23[C@H]4c5ccccc5[C@H](c5cc(C(F)(F)F)c(C(F)(F)F)cc54)[C@]12[C@H]1C=C[C@@H]3C1 |
| InChI | InChI=1S/C25H14F6O3/c26-24(27,28)16-8-14-15(9-17(16)25(29,30)31)19-13-4-2-1-3-12(13)18(14)22-10-5-6-11(7-10)23(19,22)21(33)34-20(22)32/h1-6,8-11,18-19H,7H2/t10-,11+,18+,19-,22+,23- |
| InChIKey | KHXMAKCQUKUIAX-BMHXRUQASA-N |
| XLogP | 5.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.37 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|