About dimethyl 3-[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]benzoyl]-1H-indole-4,7-dicarboxylate
dimethyl 3-[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]benzoyl]-1H-indole-4,7-dicarboxylate (PubChem CID 10672429) has the molecular formula C27H22N4O5
and a molecular weight of 482.50 g/mol. Its IUPAC name is dimethyl 3-[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]benzoyl]-1H-indole-4,7-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 3-[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]benzoyl]-1H-indole-4,7-dicarboxylate |
| PubChem CID | 10672429 |
| Molecular Formula | C27H22N4O5 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | dimethyl 3-[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]benzoyl]-1H-indole-4,7-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c2c(C(=O)c3ccc(Cn4c(C)nc5cnccc54)cc3)c[nH]c12 |
| InChI | InChI=1S/C27H22N4O5/c1-15-30-21-13-28-11-10-22(21)31(15)14-16-4-6-17(7-5-16)25(32)20-12-29-24-19(27(34)36-3)9-8-18(23(20)24)26(33)35-2/h4-13,29H,14H2,1-3H3 |
| InChIKey | ZNHBKGCJMBDLGW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze dimethyl 3-[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]benzoyl]-1H-indole-4,7-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 3-[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]benzoyl]-1H-indole-4,7-dicarboxylate?
The IUPAC name of dimethyl 3-[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]benzoyl]-1H-indole-4,7-dicarboxylate (CID 10672429) is dimethyl 3-[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]benzoyl]-1H-indole-4,7-dicarboxylate.
What is the SMILES notation for dimethyl 3-[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]benzoyl]-1H-indole-4,7-dicarboxylate?
The canonical SMILES for dimethyl 3-[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]benzoyl]-1H-indole-4,7-dicarboxylate is COC(=O)c1ccc(C(=O)OC)c2c(C(=O)c3ccc(Cn4c(C)nc5cnccc54)cc3)c[nH]c12.
What is the InChIKey of dimethyl 3-[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]benzoyl]-1H-indole-4,7-dicarboxylate?
The InChIKey is ZNHBKGCJMBDLGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H22N4O5/c1-15-30-21-13-28-11-10-22(21)31(15)14-16-4-6-17(7-5-16)25(32)20-12-29-24-19(27(34)36-3)9-8-18(23(20)24)26(33)35-2/h4-13,29H,14H2,1-3H3.
What are the key properties of dimethyl 3-[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]benzoyl]-1H-indole-4,7-dicarboxylate?
dimethyl 3-[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]benzoyl]-1H-indole-4,7-dicarboxylate has a molecular weight of 482.50 g/mol, XLogP of 4.07, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 3-[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]benzoyl]-1H-indole-4,7-dicarboxylate is sourced from PubChem (CID 10672429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).