C26H33N3O4S — CID 10672477
ethyl 5-(diethylaminomethyl)-3-(3,4-dimethoxyphenyl)-8-thia-6,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-4-carboxylate (PubChem CID 10672477) has the molecular formula C26H33N3O4S and a molecular weight of 483.63 g/mol. Its IUPAC name is ethyl 5-(diethylaminomethyl)-3-(3,4-dimethoxyphenyl)-8-thia-6,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-4-carboxylate.
| Compound Name | ethyl 5-(diethylaminomethyl)-3-(3,4-dimethoxyphenyl)-8-thia-6,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-4-carboxylate |
|---|---|
| PubChem CID | 10672477 |
| Molecular Formula | C26H33N3O4S |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | ethyl 5-(diethylaminomethyl)-3-(3,4-dimethoxyphenyl)-8-thia-6,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-4-carboxylate |
| SMILES | CCOC(=O)c1c(CN(CC)CC)nc2sc3c(c2c1-c1ccc(OC)c(OC)c1)CCCN3 |
| InChI | InChI=1S/C26H33N3O4S/c1-6-29(7-2)15-18-23(26(30)33-8-3)21(16-11-12-19(31-4)20(14-16)32-5)22-17-10-9-13-27-24(17)34-25(22)28-18/h11-12,14,27H,6-10,13,15H2,1-5H3 |
| InChIKey | FJRDQIGFNLRKMK-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |