C11H22N2O3S2 — CID 106724887
4-(2-tert-butylsulfonylethyl)morpholine-2-carbothioamide (PubChem CID 106724887) has the molecular formula C11H22N2O3S2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 4-(2-tert-butylsulfonylethyl)morpholine-2-carbothioamide.
| Compound Name | 4-(2-tert-butylsulfonylethyl)morpholine-2-carbothioamide |
|---|---|
| PubChem CID | 106724887 |
| Molecular Formula | C11H22N2O3S2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 4-(2-tert-butylsulfonylethyl)morpholine-2-carbothioamide |
| SMILES | CC(C)(C)S(=O)(=O)CCN1CCOC(C(N)=S)C1 |
| InChI | InChI=1S/C11H22N2O3S2/c1-11(2,3)18(14,15)7-5-13-4-6-16-9(8-13)10(12)17/h9H,4-8H2,1-3H3,(H2,12,17) |
| InChIKey | DPCQCBIRVZNUAH-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|