C22H35NO7SSi — CID 10672558
prop-2-enyl 2-[(3R,4S)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-2-oxo-4-[(2R)-oxolane-2-carbonyl]sulfanylazetidin-1-yl]-2-oxoacetate (PubChem CID 10672558) has the molecular formula C22H35NO7SSi and a molecular weight of 485.68 g/mol. Its IUPAC name is prop-2-enyl 2-[(3R,4S)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-2-oxo-4-[(2R)-oxolane-2-carbonyl]sulfanylazetidin-1-yl]-2-oxoacetate.
| Compound Name | prop-2-enyl 2-[(3R,4S)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-2-oxo-4-[(2R)-oxolane-2-carbonyl]sulfanylazetidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 10672558 |
| Molecular Formula | C22H35NO7SSi |
| Molecular Weight | 485.68 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | prop-2-enyl 2-[(3R,4S)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-2-oxo-4-[(2R)-oxolane-2-carbonyl]sulfanylazetidin-1-yl]-2-oxoacetate |
| SMILES | C=CCOC(=O)C(=O)N1C(=O)[C@@H]([C@H](CC)O[Si](C)(C)C(C)(C)C)[C@@H]1SC(=O)[C@H]1CCCO1 |
| InChI | InChI=1S/C22H35NO7SSi/c1-8-12-29-20(26)18(25)23-17(24)16(14(9-2)30-32(6,7)22(3,4)5)19(23)31-21(27)15-11-10-13-28-15/h8,14-16,19H,1,9-13H2,2-7H3/t14-,15+,16+,19-/m0/s1 |
| InChIKey | IMSZSMSGFOHGET-MKSNKDDYSA-N |
| XLogP | 3.27 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.68 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|