C30H51FO2Si — CID 10672715
ethyl (5E,9E,13Z,17Z)-13-fluoro-5,9,14-trimethyl-2-propan-2-ylidene-19-trimethylsilylnonadeca-5,9,13,17-tetraenoate (PubChem CID 10672715) has the molecular formula C30H51FO2Si and a molecular weight of 490.82 g/mol. Its IUPAC name is ethyl (5E,9E,13Z,17Z)-13-fluoro-5,9,14-trimethyl-2-propan-2-ylidene-19-trimethylsilylnonadeca-5,9,13,17-tetraenoate.
| Compound Name | ethyl (5E,9E,13Z,17Z)-13-fluoro-5,9,14-trimethyl-2-propan-2-ylidene-19-trimethylsilylnonadeca-5,9,13,17-tetraenoate |
|---|---|
| PubChem CID | 10672715 |
| Molecular Formula | C30H51FO2Si |
| Molecular Weight | 490.82 g/mol |
| Exact Mass | 490.36 |
| IUPAC Name | ethyl (5E,9E,13Z,17Z)-13-fluoro-5,9,14-trimethyl-2-propan-2-ylidene-19-trimethylsilylnonadeca-5,9,13,17-tetraenoate |
| SMILES | CCOC(=O)C(CC/C(C)=C/CC/C(C)=C/CC/C(F)=C(\C)CC/C=C\C[Si](C)(C)C)=C(C)C |
| InChI | InChI=1S/C30H51FO2Si/c1-10-33-30(32)28(24(2)3)22-21-26(5)17-14-16-25(4)18-15-20-29(31)27(6)19-12-11-13-23-34(7,8)9/h11,13,17-18H,10,12,14-16,19-23H2,1-9H3/b13-11-,25-18+,26-17+,29-27- |
| InChIKey | ZMPJCSMWAYHETF-LWVGTZCGSA-N |
| XLogP | 10.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.82 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|