C14H27N3O3S — CID 106727923
piperazin-1-yl-[1-(2-propan-2-ylsulfonylethyl)pyrrolidin-2-yl]methanone (PubChem CID 106727923) has the molecular formula C14H27N3O3S and a molecular weight of 317.46 g/mol. Its IUPAC name is piperazin-1-yl-[1-(2-propan-2-ylsulfonylethyl)pyrrolidin-2-yl]methanone.
| Compound Name | piperazin-1-yl-[1-(2-propan-2-ylsulfonylethyl)pyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 106727923 |
| Molecular Formula | C14H27N3O3S |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | piperazin-1-yl-[1-(2-propan-2-ylsulfonylethyl)pyrrolidin-2-yl]methanone |
| SMILES | CC(C)S(=O)(=O)CCN1CCCC1C(=O)N1CCNCC1 |
| InChI | InChI=1S/C14H27N3O3S/c1-12(2)21(19,20)11-10-16-7-3-4-13(16)14(18)17-8-5-15-6-9-17/h12-13,15H,3-11H2,1-2H3 |
| InChIKey | CXDWKUQHMQEWNL-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |