C10H14Cl2N2O3S — CID 106728648
3-(2-tert-butylsulfonylethyl)-5,6-dichloropyrimidin-4-one (PubChem CID 106728648) has the molecular formula C10H14Cl2N2O3S and a molecular weight of 313.21 g/mol. Its IUPAC name is 3-(2-tert-butylsulfonylethyl)-5,6-dichloropyrimidin-4-one.
| Compound Name | 3-(2-tert-butylsulfonylethyl)-5,6-dichloropyrimidin-4-one |
|---|---|
| PubChem CID | 106728648 |
| Molecular Formula | C10H14Cl2N2O3S |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 3-(2-tert-butylsulfonylethyl)-5,6-dichloropyrimidin-4-one |
| SMILES | CC(C)(C)S(=O)(=O)CCn1cnc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C10H14Cl2N2O3S/c1-10(2,3)18(16,17)5-4-14-6-13-8(12)7(11)9(14)15/h6H,4-5H2,1-3H3 |
| InChIKey | YOWQLTCTOQGORU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |