C10H21NO4S — CID 106729248
1-(2-tert-butylsulfonylethyl)pyrrolidine-3,4-diol (PubChem CID 106729248) has the molecular formula C10H21NO4S and a molecular weight of 251.35 g/mol. Its IUPAC name is 1-(2-tert-butylsulfonylethyl)pyrrolidine-3,4-diol.
| Compound Name | 1-(2-tert-butylsulfonylethyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106729248 |
| Molecular Formula | C10H21NO4S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 1-(2-tert-butylsulfonylethyl)pyrrolidine-3,4-diol |
| SMILES | CC(C)(C)S(=O)(=O)CCN1CC(O)C(O)C1 |
| InChI | InChI=1S/C10H21NO4S/c1-10(2,3)16(14,15)5-4-11-6-8(12)9(13)7-11/h8-9,12-13H,4-7H2,1-3H3 |
| InChIKey | QWZVVEPFMKCAHZ-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |