About 1-(2-tert-butylsulfonylethyl)pyrrolidine-3,4-diol
1-(2-tert-butylsulfonylethyl)pyrrolidine-3,4-diol (PubChem CID 106729248) has the molecular formula C10H21NO4S
and a molecular weight of 251.35 g/mol. Its IUPAC name is 1-(2-tert-butylsulfonylethyl)pyrrolidine-3,4-diol.
Molecular Properties
| Compound Name | 1-(2-tert-butylsulfonylethyl)pyrrolidine-3,4-diol |
| PubChem CID | 106729248 |
| Molecular Formula | C10H21NO4S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 1-(2-tert-butylsulfonylethyl)pyrrolidine-3,4-diol |
| SMILES | CC(C)(C)S(=O)(=O)CCN1CC(O)C(O)C1 |
| InChI | InChI=1S/C10H21NO4S/c1-10(2,3)16(14,15)5-4-11-6-8(12)9(13)7-11/h8-9,12-13H,4-7H2,1-3H3 |
| InChIKey | QWZVVEPFMKCAHZ-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2-tert-butylsulfonylethyl)pyrrolidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-tert-butylsulfonylethyl)pyrrolidine-3,4-diol?
The IUPAC name of 1-(2-tert-butylsulfonylethyl)pyrrolidine-3,4-diol (CID 106729248) is 1-(2-tert-butylsulfonylethyl)pyrrolidine-3,4-diol.
What is the SMILES notation for 1-(2-tert-butylsulfonylethyl)pyrrolidine-3,4-diol?
The canonical SMILES for 1-(2-tert-butylsulfonylethyl)pyrrolidine-3,4-diol is CC(C)(C)S(=O)(=O)CCN1CC(O)C(O)C1.
What is the InChIKey of 1-(2-tert-butylsulfonylethyl)pyrrolidine-3,4-diol?
The InChIKey is QWZVVEPFMKCAHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO4S/c1-10(2,3)16(14,15)5-4-11-6-8(12)9(13)7-11/h8-9,12-13H,4-7H2,1-3H3.
What are the key properties of 1-(2-tert-butylsulfonylethyl)pyrrolidine-3,4-diol?
1-(2-tert-butylsulfonylethyl)pyrrolidine-3,4-diol has a molecular weight of 251.35 g/mol, XLogP of -0.76, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-tert-butylsulfonylethyl)pyrrolidine-3,4-diol is sourced from PubChem (CID 106729248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).