C21H41BrO4Si2 — CID 10672952
[(3aR,4S,5R,7aS)-7-bromo-4-[tert-butyl(dimethyl)silyl]oxy-3a,4,5,6,7a-pentadeuterio-2,2-dimethyl-1,3-benzodioxol-5-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10672952) has the molecular formula C21H41BrO4Si2 and a molecular weight of 498.66 g/mol. Its IUPAC name is [(3aR,4S,5R,7aS)-7-bromo-4-[tert-butyl(dimethyl)silyl]oxy-3a,4,5,6,7a-pentadeuterio-2,2-dimethyl-1,3-benzodioxol-5-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,4S,5R,7aS)-7-bromo-4-[tert-butyl(dimethyl)silyl]oxy-3a,4,5,6,7a-pentadeuterio-2,2-dimethyl-1,3-benzodioxol-5-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10672952 |
| Molecular Formula | C21H41BrO4Si2 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | [(3aR,4S,5R,7aS)-7-bromo-4-[tert-butyl(dimethyl)silyl]oxy-3a,4,5,6,7a-pentadeuterio-2,2-dimethyl-1,3-benzodioxol-5-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | [2H]C1=C(Br)[C@@]2([2H])OC(C)(C)O[C@@]2([2H])[C@]([2H])(O[Si](C)(C)C(C)(C)C)[C@]1([2H])O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H41BrO4Si2/c1-19(2,3)27(9,10)25-15-13-14(22)16-18(24-21(7,8)23-16)17(15)26-28(11,12)20(4,5)6/h13,15-18H,1-12H3/t15-,16-,17-,18-/m1/s1/i13D,15D,16D,17D,18D |
| InChIKey | DCGMTPHNTUBKKV-CEVNBMINSA-N |
| XLogP | 6.58 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|