C24H27ClFN7O2 — CID 10672994
N-[4-(3-chloro-4-fluoroanilino)-7-[3-(4-methylpiperazin-1-yl)propoxy]pyrido[3,2-d]pyrimidin-6-yl]prop-2-enamide (PubChem CID 10672994) has the molecular formula C24H27ClFN7O2 and a molecular weight of 499.98 g/mol. Its IUPAC name is N-[4-(3-chloro-4-fluoroanilino)-7-[3-(4-methylpiperazin-1-yl)propoxy]pyrido[3,2-d]pyrimidin-6-yl]prop-2-enamide.
| Compound Name | N-[4-(3-chloro-4-fluoroanilino)-7-[3-(4-methylpiperazin-1-yl)propoxy]pyrido[3,2-d]pyrimidin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 10672994 |
| Molecular Formula | C24H27ClFN7O2 |
| Molecular Weight | 499.98 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | N-[4-(3-chloro-4-fluoroanilino)-7-[3-(4-methylpiperazin-1-yl)propoxy]pyrido[3,2-d]pyrimidin-6-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1nc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C24H27ClFN7O2/c1-3-21(34)30-23-20(35-12-4-7-33-10-8-32(2)9-11-33)14-19-22(31-23)24(28-15-27-19)29-16-5-6-18(26)17(25)13-16/h3,5-6,13-15H,1,4,7-12H2,2H3,(H,27,28,29)(H,30,31,34) |
| InChIKey | FNDAEXWGUUPCOX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.98 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|