C16H34N2O2S — CID 106733118
1-(2-tert-butylsulfonylethyl)-5-ethyl-5-methyl-2-propylpiperazine (PubChem CID 106733118) has the molecular formula C16H34N2O2S and a molecular weight of 318.53 g/mol. Its IUPAC name is 1-(2-tert-butylsulfonylethyl)-5-ethyl-5-methyl-2-propylpiperazine.
| Compound Name | 1-(2-tert-butylsulfonylethyl)-5-ethyl-5-methyl-2-propylpiperazine |
|---|---|
| PubChem CID | 106733118 |
| Molecular Formula | C16H34N2O2S |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 1-(2-tert-butylsulfonylethyl)-5-ethyl-5-methyl-2-propylpiperazine |
| SMILES | CCCC1CNC(C)(CC)CN1CCS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C16H34N2O2S/c1-7-9-14-12-17-16(6,8-2)13-18(14)10-11-21(19,20)15(3,4)5/h14,17H,7-13H2,1-6H3 |
| InChIKey | OUZSSURSJFMKDD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |