C13H28N2O2S — CID 106733365
3-ethyl-3-methyl-1-(2-propan-2-ylsulfonylethyl)-1,4-diazepane (PubChem CID 106733365) has the molecular formula C13H28N2O2S and a molecular weight of 276.45 g/mol. Its IUPAC name is 3-ethyl-3-methyl-1-(2-propan-2-ylsulfonylethyl)-1,4-diazepane.
| Compound Name | 3-ethyl-3-methyl-1-(2-propan-2-ylsulfonylethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 106733365 |
| Molecular Formula | C13H28N2O2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 3-ethyl-3-methyl-1-(2-propan-2-ylsulfonylethyl)-1,4-diazepane |
| SMILES | CCC1(C)CN(CCS(=O)(=O)C(C)C)CCCN1 |
| InChI | InChI=1S/C13H28N2O2S/c1-5-13(4)11-15(8-6-7-14-13)9-10-18(16,17)12(2)3/h12,14H,5-11H2,1-4H3 |
| InChIKey | GRCCNISBTQLKCE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |