C28H56O4Si2 — CID 10673340
tert-butyl-[(E,1S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(E)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]non-2-enoxy]-dimethylsilane (PubChem CID 10673340) has the molecular formula C28H56O4Si2 and a molecular weight of 512.92 g/mol. Its IUPAC name is tert-butyl-[(E,1S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(E)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]non-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E,1S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(E)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]non-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10673340 |
| Molecular Formula | C28H56O4Si2 |
| Molecular Weight | 512.92 g/mol |
| Exact Mass | 512.37 |
| IUPAC Name | tert-butyl-[(E,1S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(E)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]non-2-enoxy]-dimethylsilane |
| SMILES | CCCCC[C@H](/C=C/[C@H](/C=C/[C@H]1COC(C)(C)O1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H56O4Si2/c1-14-15-16-17-23(31-33(10,11)26(2,3)4)18-19-24(32-34(12,13)27(5,6)7)20-21-25-22-29-28(8,9)30-25/h18-21,23-25H,14-17,22H2,1-13H3/b19-18+,21-20+/t23-,24-,25+/m1/s1 |
| InChIKey | ZHUKVYWRCCFQTC-OZPDVWPYSA-N |
| XLogP | 8.61 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.92 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|