C12H7ClF5N3O6S3 — CID 10673405
4-chloro-6-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]benzene-1,3-disulfonamide (PubChem CID 10673405) has the molecular formula C12H7ClF5N3O6S3 and a molecular weight of 515.85 g/mol. Its IUPAC name is 4-chloro-6-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]benzene-1,3-disulfonamide.
| Compound Name | 4-chloro-6-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 10673405 |
| Molecular Formula | C12H7ClF5N3O6S3 |
| Molecular Weight | 515.85 g/mol |
| Exact Mass | 514.91 |
| IUPAC Name | 4-chloro-6-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]benzene-1,3-disulfonamide |
| SMILES | NS(=O)(=O)c1cc(S(N)(=O)=O)c(NS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1Cl |
| InChI | InChI=1S/C12H7ClF5N3O6S3/c13-3-1-4(6(29(20,24)25)2-5(3)28(19,22)23)21-30(26,27)12-10(17)8(15)7(14)9(16)11(12)18/h1-2,21H,(H2,19,22,23)(H2,20,24,25) |
| InChIKey | ZBLJCLKBDJGJAM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 166.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.85 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|