C26H41N3O6Si — CID 10673523
tert-butyl-[[(1S,5R,6R)-3-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methyl-6-nitro-5-(4-nitrophenyl)cyclohex-2-en-1-yl]methoxy]-dimethylsilane (PubChem CID 10673523) has the molecular formula C26H41N3O6Si and a molecular weight of 519.72 g/mol. Its IUPAC name is tert-butyl-[[(1S,5R,6R)-3-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methyl-6-nitro-5-(4-nitrophenyl)cyclohex-2-en-1-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,5R,6R)-3-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methyl-6-nitro-5-(4-nitrophenyl)cyclohex-2-en-1-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10673523 |
| Molecular Formula | C26H41N3O6Si |
| Molecular Weight | 519.72 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | tert-butyl-[[(1S,5R,6R)-3-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methyl-6-nitro-5-(4-nitrophenyl)cyclohex-2-en-1-yl]methoxy]-dimethylsilane |
| SMILES | COC[C@@H]1CCCN1C1=C(C)[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]([N+](=O)[O-])[C@@H](c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C26H41N3O6Si/c1-18-23(17-35-36(6,7)26(2,3)4)25(29(32)33)22(19-10-12-20(13-11-19)28(30)31)15-24(18)27-14-8-9-21(27)16-34-5/h10-13,21-23,25H,8-9,14-17H2,1-7H3/t21-,22+,23-,25+/m0/s1 |
| InChIKey | YJJQYHMNPVPJGT-ONTNHIFESA-N |
| XLogP | 5.75 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.72 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|