C15H29NO2S — CID 106735497
N-[[2-(2-tert-butylsulfonylethyl)cyclopentyl]methyl]cyclopropanamine (PubChem CID 106735497) has the molecular formula C15H29NO2S and a molecular weight of 287.47 g/mol. Its IUPAC name is N-[[2-(2-tert-butylsulfonylethyl)cyclopentyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-(2-tert-butylsulfonylethyl)cyclopentyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 106735497 |
| Molecular Formula | C15H29NO2S |
| Molecular Weight | 287.47 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | N-[[2-(2-tert-butylsulfonylethyl)cyclopentyl]methyl]cyclopropanamine |
| SMILES | CC(C)(C)S(=O)(=O)CCC1CCCC1CNC1CC1 |
| InChI | InChI=1S/C15H29NO2S/c1-15(2,3)19(17,18)10-9-12-5-4-6-13(12)11-16-14-7-8-14/h12-14,16H,4-11H2,1-3H3 |
| InChIKey | FCUILRDQHGOVQE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |