C36H42O3 — CID 10673597
1-[(3R,5R,8R,9S,10S,13S,14S,17S)-3-[2-(4-benzoylphenyl)ethynyl]-3-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 10673597) has the molecular formula C36H42O3 and a molecular weight of 522.73 g/mol. Its IUPAC name is 1-[(3R,5R,8R,9S,10S,13S,14S,17S)-3-[2-(4-benzoylphenyl)ethynyl]-3-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(3R,5R,8R,9S,10S,13S,14S,17S)-3-[2-(4-benzoylphenyl)ethynyl]-3-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 10673597 |
| Molecular Formula | C36H42O3 |
| Molecular Weight | 522.73 g/mol |
| Exact Mass | 522.31 |
| IUPAC Name | 1-[(3R,5R,8R,9S,10S,13S,14S,17S)-3-[2-(4-benzoylphenyl)ethynyl]-3-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@@](O)(C#Cc5ccc(C(=O)c6ccccc6)cc5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C36H42O3/c1-24(37)30-15-16-31-29-14-13-28-23-36(39,22-21-34(28,2)32(29)18-19-35(30,31)3)20-17-25-9-11-27(12-10-25)33(38)26-7-5-4-6-8-26/h4-12,28-32,39H,13-16,18-19,21-23H2,1-3H3/t28-,29+,30-,31+,32+,34+,35-,36-/m1/s1 |
| InChIKey | VAINLEBGZMRDFZ-OEJVEXDDSA-N |
| XLogP | 7.25 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.73 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|