C14H28FNO2S — CID 106735976
2-(4-tert-butylsulfonyl-2-fluoro-2-methylbutyl)piperidine (PubChem CID 106735976) has the molecular formula C14H28FNO2S and a molecular weight of 293.45 g/mol. Its IUPAC name is 2-(4-tert-butylsulfonyl-2-fluoro-2-methylbutyl)piperidine.
| Compound Name | 2-(4-tert-butylsulfonyl-2-fluoro-2-methylbutyl)piperidine |
|---|---|
| PubChem CID | 106735976 |
| Molecular Formula | C14H28FNO2S |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 2-(4-tert-butylsulfonyl-2-fluoro-2-methylbutyl)piperidine |
| SMILES | CC(F)(CCS(=O)(=O)C(C)(C)C)CC1CCCCN1 |
| InChI | InChI=1S/C14H28FNO2S/c1-13(2,3)19(17,18)10-8-14(4,15)11-12-7-5-6-9-16-12/h12,16H,5-11H2,1-4H3 |
| InChIKey | IZISDMDFMLUQLO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |