C10H19NO5S — CID 106736029
2-methyl-2-(methylcarbamoyl)-4-propylsulfonylbutanoic acid (PubChem CID 106736029) has the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. Its IUPAC name is 2-methyl-2-(methylcarbamoyl)-4-propylsulfonylbutanoic acid.
| Compound Name | 2-methyl-2-(methylcarbamoyl)-4-propylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 106736029 |
| Molecular Formula | C10H19NO5S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 2-methyl-2-(methylcarbamoyl)-4-propylsulfonylbutanoic acid |
| SMILES | CCCS(=O)(=O)CCC(C)(C(=O)O)C(=O)NC |
| InChI | InChI=1S/C10H19NO5S/c1-4-6-17(15,16)7-5-10(2,9(13)14)8(12)11-3/h4-7H2,1-3H3,(H,11,12)(H,13,14) |
| InChIKey | APEQIMNGOGKUBU-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|