About 8-amino-1-ethylsulfonyl-6,6-dimethyloctan-3-one
8-amino-1-ethylsulfonyl-6,6-dimethyloctan-3-one (PubChem CID 106736461) has the molecular formula C12H25NO3S
and a molecular weight of 263.40 g/mol. Its IUPAC name is 8-amino-1-ethylsulfonyl-6,6-dimethyloctan-3-one.
Molecular Properties
| Compound Name | 8-amino-1-ethylsulfonyl-6,6-dimethyloctan-3-one |
| PubChem CID | 106736461 |
| Molecular Formula | C12H25NO3S |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 8-amino-1-ethylsulfonyl-6,6-dimethyloctan-3-one |
| SMILES | CCS(=O)(=O)CCC(=O)CCC(C)(C)CCN |
| InChI | InChI=1S/C12H25NO3S/c1-4-17(15,16)10-6-11(14)5-7-12(2,3)8-9-13/h4-10,13H2,1-3H3 |
| InChIKey | VLIWCGHWUQGHPF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.40 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-amino-1-ethylsulfonyl-6,6-dimethyloctan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-1-ethylsulfonyl-6,6-dimethyloctan-3-one?
The IUPAC name of 8-amino-1-ethylsulfonyl-6,6-dimethyloctan-3-one (CID 106736461) is 8-amino-1-ethylsulfonyl-6,6-dimethyloctan-3-one.
What is the SMILES notation for 8-amino-1-ethylsulfonyl-6,6-dimethyloctan-3-one?
The canonical SMILES for 8-amino-1-ethylsulfonyl-6,6-dimethyloctan-3-one is CCS(=O)(=O)CCC(=O)CCC(C)(C)CCN.
What is the InChIKey of 8-amino-1-ethylsulfonyl-6,6-dimethyloctan-3-one?
The InChIKey is VLIWCGHWUQGHPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO3S/c1-4-17(15,16)10-6-11(14)5-7-12(2,3)8-9-13/h4-10,13H2,1-3H3.
What are the key properties of 8-amino-1-ethylsulfonyl-6,6-dimethyloctan-3-one?
8-amino-1-ethylsulfonyl-6,6-dimethyloctan-3-one has a molecular weight of 263.40 g/mol, XLogP of 1.54, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-1-ethylsulfonyl-6,6-dimethyloctan-3-one is sourced from PubChem (CID 106736461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).