About 8-amino-1-tert-butylsulfonyl-6,6-dimethyloctan-3-one
8-amino-1-tert-butylsulfonyl-6,6-dimethyloctan-3-one (PubChem CID 106736462) has the molecular formula C14H29NO3S
and a molecular weight of 291.46 g/mol. Its IUPAC name is 8-amino-1-tert-butylsulfonyl-6,6-dimethyloctan-3-one.
Molecular Properties
| Compound Name | 8-amino-1-tert-butylsulfonyl-6,6-dimethyloctan-3-one |
| PubChem CID | 106736462 |
| Molecular Formula | C14H29NO3S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 8-amino-1-tert-butylsulfonyl-6,6-dimethyloctan-3-one |
| SMILES | CC(C)(CCN)CCC(=O)CCS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C14H29NO3S/c1-13(2,3)19(17,18)11-7-12(16)6-8-14(4,5)9-10-15/h6-11,15H2,1-5H3 |
| InChIKey | XPQUZQVXVKFBSA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-amino-1-tert-butylsulfonyl-6,6-dimethyloctan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-1-tert-butylsulfonyl-6,6-dimethyloctan-3-one?
The IUPAC name of 8-amino-1-tert-butylsulfonyl-6,6-dimethyloctan-3-one (CID 106736462) is 8-amino-1-tert-butylsulfonyl-6,6-dimethyloctan-3-one.
What is the SMILES notation for 8-amino-1-tert-butylsulfonyl-6,6-dimethyloctan-3-one?
The canonical SMILES for 8-amino-1-tert-butylsulfonyl-6,6-dimethyloctan-3-one is CC(C)(CCN)CCC(=O)CCS(=O)(=O)C(C)(C)C.
What is the InChIKey of 8-amino-1-tert-butylsulfonyl-6,6-dimethyloctan-3-one?
The InChIKey is XPQUZQVXVKFBSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO3S/c1-13(2,3)19(17,18)11-7-12(16)6-8-14(4,5)9-10-15/h6-11,15H2,1-5H3.
What are the key properties of 8-amino-1-tert-butylsulfonyl-6,6-dimethyloctan-3-one?
8-amino-1-tert-butylsulfonyl-6,6-dimethyloctan-3-one has a molecular weight of 291.46 g/mol, XLogP of 2.31, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-1-tert-butylsulfonyl-6,6-dimethyloctan-3-one is sourced from PubChem (CID 106736462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).