C36H35NOS — CID 10673764
(1R,2S,3S)-3-(dibenzylamino)-1,4-diphenyl-1-phenylsulfanylbutan-2-ol (PubChem CID 10673764) has the molecular formula C36H35NOS and a molecular weight of 529.75 g/mol. Its IUPAC name is (1R,2S,3S)-3-(dibenzylamino)-1,4-diphenyl-1-phenylsulfanylbutan-2-ol.
| Compound Name | (1R,2S,3S)-3-(dibenzylamino)-1,4-diphenyl-1-phenylsulfanylbutan-2-ol |
|---|---|
| PubChem CID | 10673764 |
| Molecular Formula | C36H35NOS |
| Molecular Weight | 529.75 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | (1R,2S,3S)-3-(dibenzylamino)-1,4-diphenyl-1-phenylsulfanylbutan-2-ol |
| SMILES | O[C@H]([C@H](Sc1ccccc1)c1ccccc1)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C36H35NOS/c38-35(36(32-22-12-4-13-23-32)39-33-24-14-5-15-25-33)34(26-29-16-6-1-7-17-29)37(27-30-18-8-2-9-19-30)28-31-20-10-3-11-21-31/h1-25,34-36,38H,26-28H2/t34-,35-,36+/m0/s1 |
| InChIKey | UNIMNBZFPDSYJE-QGBCWPEESA-N |
| XLogP | 8.19 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.75 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |