C9H17N3O2S — CID 106737773
N-(2-amino-1-cyclopentylethyl)-1-cyanomethanesulfonamide (PubChem CID 106737773) has the molecular formula C9H17N3O2S and a molecular weight of 231.32 g/mol. Its IUPAC name is N-(2-amino-1-cyclopentylethyl)-1-cyanomethanesulfonamide.
| Compound Name | N-(2-amino-1-cyclopentylethyl)-1-cyanomethanesulfonamide |
|---|---|
| PubChem CID | 106737773 |
| Molecular Formula | C9H17N3O2S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | N-(2-amino-1-cyclopentylethyl)-1-cyanomethanesulfonamide |
| SMILES | N#CCS(=O)(=O)NC(CN)C1CCCC1 |
| InChI | InChI=1S/C9H17N3O2S/c10-5-6-15(13,14)12-9(7-11)8-3-1-2-4-8/h8-9,12H,1-4,6-7,11H2 |
| InChIKey | WVIUQRCSXXFBMD-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |