C26H41F3O4SSi — CID 10673884
[(3aR,5aR,6R,10aS)-6-[tert-butyl(dimethyl)silyl]oxy-3a,5a-dimethyl-1-propan-2-yl-2,3,4,5,6,10a-hexahydrocyclohepta[e]inden-8-yl] trifluoromethanesulfonate (PubChem CID 10673884) has the molecular formula C26H41F3O4SSi and a molecular weight of 534.76 g/mol. Its IUPAC name is [(3aR,5aR,6R,10aS)-6-[tert-butyl(dimethyl)silyl]oxy-3a,5a-dimethyl-1-propan-2-yl-2,3,4,5,6,10a-hexahydrocyclohepta[e]inden-8-yl] trifluoromethanesulfonate.
| Compound Name | [(3aR,5aR,6R,10aS)-6-[tert-butyl(dimethyl)silyl]oxy-3a,5a-dimethyl-1-propan-2-yl-2,3,4,5,6,10a-hexahydrocyclohepta[e]inden-8-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10673884 |
| Molecular Formula | C26H41F3O4SSi |
| Molecular Weight | 534.76 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | [(3aR,5aR,6R,10aS)-6-[tert-butyl(dimethyl)silyl]oxy-3a,5a-dimethyl-1-propan-2-yl-2,3,4,5,6,10a-hexahydrocyclohepta[e]inden-8-yl] trifluoromethanesulfonate |
| SMILES | CC(C)C1=C2[C@@H]3C=CC(OS(=O)(=O)C(F)(F)F)=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@]3(C)CC[C@@]2(C)CC1 |
| InChI | InChI=1S/C26H41F3O4SSi/c1-17(2)19-12-13-24(6)14-15-25(7)20(22(19)24)11-10-18(32-34(30,31)26(27,28)29)16-21(25)33-35(8,9)23(3,4)5/h10-11,16-17,20-21H,12-15H2,1-9H3/t20-,21+,24+,25+/m0/s1 |
| InChIKey | MJSPEUGFGMRMDW-ZNDGRNAPSA-N |
| XLogP | 7.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.76 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|