C10H7ClF6N2O — CID 106741523
N-(6-chloro-5-methyl-3-pyridinyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide (PubChem CID 106741523) has the molecular formula C10H7ClF6N2O and a molecular weight of 320.62 g/mol. Its IUPAC name is N-(6-chloro-5-methyl-3-pyridinyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide.
| Compound Name | N-(6-chloro-5-methyl-3-pyridinyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 106741523 |
| Molecular Formula | C10H7ClF6N2O |
| Molecular Weight | 320.62 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | N-(6-chloro-5-methyl-3-pyridinyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
| SMILES | Cc1cc(NC(=O)C(C(F)(F)F)C(F)(F)F)cnc1Cl |
| InChI | InChI=1S/C10H7ClF6N2O/c1-4-2-5(3-18-7(4)11)19-8(20)6(9(12,13)14)10(15,16)17/h2-3,6H,1H3,(H,19,20) |
| InChIKey | UQLDPACQAIEDJX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.62 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|