About 2-chloro-5-hydroxy-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide
2-chloro-5-hydroxy-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide (PubChem CID 106741546) has the molecular formula C10H9ClF3NO3
and a molecular weight of 283.63 g/mol. Its IUPAC name is 2-chloro-5-hydroxy-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide.
Molecular Properties
| Compound Name | 2-chloro-5-hydroxy-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide |
| PubChem CID | 106741546 |
| Molecular Formula | C10H9ClF3NO3 |
| Molecular Weight | 283.63 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 2-chloro-5-hydroxy-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide |
| SMILES | O=C(NCC(O)C(F)(F)F)c1cc(O)ccc1Cl |
| InChI | InChI=1S/C10H9ClF3NO3/c11-7-2-1-5(16)3-6(7)9(18)15-4-8(17)10(12,13)14/h1-3,8,16-17H,4H2,(H,15,18) |
| InChIKey | WSHCZXMHNZKTPD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.63 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-5-hydroxy-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-hydroxy-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide?
The IUPAC name of 2-chloro-5-hydroxy-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide (CID 106741546) is 2-chloro-5-hydroxy-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide.
What is the SMILES notation for 2-chloro-5-hydroxy-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide?
The canonical SMILES for 2-chloro-5-hydroxy-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide is O=C(NCC(O)C(F)(F)F)c1cc(O)ccc1Cl.
What is the InChIKey of 2-chloro-5-hydroxy-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide?
The InChIKey is WSHCZXMHNZKTPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClF3NO3/c11-7-2-1-5(16)3-6(7)9(18)15-4-8(17)10(12,13)14/h1-3,8,16-17H,4H2,(H,15,18).
What are the key properties of 2-chloro-5-hydroxy-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide?
2-chloro-5-hydroxy-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide has a molecular weight of 283.63 g/mol, XLogP of 1.70, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-hydroxy-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide is sourced from PubChem (CID 106741546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).