About 1-(2,2-difluoroacetyl)-2-methylpiperidine-4-carboxylic acid
1-(2,2-difluoroacetyl)-2-methylpiperidine-4-carboxylic acid (PubChem CID 106742109) has the molecular formula C9H13F2NO3
and a molecular weight of 221.20 g/mol. Its IUPAC name is 1-(2,2-difluoroacetyl)-2-methylpiperidine-4-carboxylic acid.
Analyze 1-(2,2-difluoroacetyl)-2-methylpiperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoroacetyl)-2-methylpiperidine-4-carboxylic acid?
The IUPAC name of 1-(2,2-difluoroacetyl)-2-methylpiperidine-4-carboxylic acid (CID 106742109) is 1-(2,2-difluoroacetyl)-2-methylpiperidine-4-carboxylic acid.
What is the SMILES notation for 1-(2,2-difluoroacetyl)-2-methylpiperidine-4-carboxylic acid?
The canonical SMILES for 1-(2,2-difluoroacetyl)-2-methylpiperidine-4-carboxylic acid is CC1CC(C(=O)O)CCN1C(=O)C(F)F.
What is the InChIKey of 1-(2,2-difluoroacetyl)-2-methylpiperidine-4-carboxylic acid?
The InChIKey is YZQCIEHLVHVOTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2NO3/c1-5-4-6(9(14)15)2-3-12(5)8(13)7(10)11/h5-7H,2-4H2,1H3,(H,14,15).
What are the key properties of 1-(2,2-difluoroacetyl)-2-methylpiperidine-4-carboxylic acid?
1-(2,2-difluoroacetyl)-2-methylpiperidine-4-carboxylic acid has a molecular weight of 221.20 g/mol, XLogP of 0.96, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoroacetyl)-2-methylpiperidine-4-carboxylic acid is sourced from PubChem (CID 106742109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).