C13H18N2O4S — CID 106742544
2-methyl-1-(3-methylsulfonyl-2-pyridinyl)piperidine-4-carboxylic acid (PubChem CID 106742544) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is 2-methyl-1-(3-methylsulfonyl-2-pyridinyl)piperidine-4-carboxylic acid.
| Compound Name | 2-methyl-1-(3-methylsulfonyl-2-pyridinyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 106742544 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-methyl-1-(3-methylsulfonyl-2-pyridinyl)piperidine-4-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CCN1c1ncccc1S(C)(=O)=O |
| InChI | InChI=1S/C13H18N2O4S/c1-9-8-10(13(16)17)5-7-15(9)12-11(20(2,18)19)4-3-6-14-12/h3-4,6,9-10H,5,7-8H2,1-2H3,(H,16,17) |
| InChIKey | FERNZVIXDREWBU-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |