C31H49N3O2SSi — CID 10674324
5-[(S)-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]methyl]-N,N-diethylthiophene-2-carboxamide (PubChem CID 10674324) has the molecular formula C31H49N3O2SSi and a molecular weight of 555.91 g/mol. Its IUPAC name is 5-[(S)-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]methyl]-N,N-diethylthiophene-2-carboxamide.
| Compound Name | 5-[(S)-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]methyl]-N,N-diethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 10674324 |
| Molecular Formula | C31H49N3O2SSi |
| Molecular Weight | 555.91 g/mol |
| Exact Mass | 555.33 |
| IUPAC Name | 5-[(S)-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]methyl]-N,N-diethylthiophene-2-carboxamide |
| SMILES | C=CCN1C[C@H](C)N(C(c2cccc(O[Si](C)(C)C(C)(C)C)c2)c2ccc(C(=O)N(CC)CC)s2)C[C@H]1C |
| InChI | InChI=1S/C31H49N3O2SSi/c1-11-19-33-21-24(5)34(22-23(33)4)29(27-17-18-28(37-27)30(35)32(12-2)13-3)25-15-14-16-26(20-25)36-38(9,10)31(6,7)8/h11,14-18,20,23-24,29H,1,12-13,19,21-22H2,2-10H3/t23-,24+,29?/m1/s1 |
| InChIKey | JEXYHJWPBRTMRR-LLZOBTIZSA-N |
| XLogP | 7.28 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.91 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|