C12H15N3OS — CID 106743244
5-(2-methylpiperidin-4-yl)-3-thiophen-2-yl-1,2,4-oxadiazole (PubChem CID 106743244) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is 5-(2-methylpiperidin-4-yl)-3-thiophen-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-(2-methylpiperidin-4-yl)-3-thiophen-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 106743244 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 5-(2-methylpiperidin-4-yl)-3-thiophen-2-yl-1,2,4-oxadiazole |
| SMILES | CC1CC(c2nc(-c3cccs3)no2)CCN1 |
| InChI | InChI=1S/C12H15N3OS/c1-8-7-9(4-5-13-8)12-14-11(15-16-12)10-3-2-6-17-10/h2-3,6,8-9,13H,4-5,7H2,1H3 |
| InChIKey | KHAQQDQEIYVWHW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |