C30H27FN4O6 — CID 10674365
benzyl 4-[4-[(5S)-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carboxylate (PubChem CID 10674365) has the molecular formula C30H27FN4O6 and a molecular weight of 558.57 g/mol. Its IUPAC name is benzyl 4-[4-[(5S)-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[4-[(5S)-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 10674365 |
| Molecular Formula | C30H27FN4O6 |
| Molecular Weight | 558.57 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | benzyl 4-[4-[(5S)-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCN(c2ccc(N3C[C@H](CN4C(=O)c5ccccc5C4=O)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C30H27FN4O6/c31-25-16-21(34-17-22(41-30(34)39)18-35-27(36)23-8-4-5-9-24(23)28(35)37)10-11-26(25)32-12-14-33(15-13-32)29(38)40-19-20-6-2-1-3-7-20/h1-11,16,22H,12-15,17-19H2/t22-/m1/s1 |
| InChIKey | XIFWGKOTCLDCLY-JOCHJYFZSA-N |
| XLogP | 3.91 |
| TPSA | 99.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|