C13H21N3O4 — CID 106743688
3-[3-(4-ethoxyoxan-4-yl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol (PubChem CID 106743688) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is 3-[3-(4-ethoxyoxan-4-yl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol.
| Compound Name | 3-[3-(4-ethoxyoxan-4-yl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 106743688 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 3-[3-(4-ethoxyoxan-4-yl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol |
| SMILES | CCOC1(c2noc(C3(O)CCNC3)n2)CCOCC1 |
| InChI | InChI=1S/C13H21N3O4/c1-2-19-13(4-7-18-8-5-13)10-15-11(20-16-10)12(17)3-6-14-9-12/h14,17H,2-9H2,1H3 |
| InChIKey | VBCFKGRKWSLVJR-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 89.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |