C30H54O9 — CID 10674375
4,12,20-trihydroxy-3,5,8,11,13,16,19,21,24-nonamethyl-1,9,17-trioxacyclotetracosane-2,10,18-trione (PubChem CID 10674375) has the molecular formula C30H54O9 and a molecular weight of 558.75 g/mol. Its IUPAC name is 4,12,20-trihydroxy-3,5,8,11,13,16,19,21,24-nonamethyl-1,9,17-trioxacyclotetracosane-2,10,18-trione.
| Compound Name | 4,12,20-trihydroxy-3,5,8,11,13,16,19,21,24-nonamethyl-1,9,17-trioxacyclotetracosane-2,10,18-trione |
|---|---|
| PubChem CID | 10674375 |
| Molecular Formula | C30H54O9 |
| Molecular Weight | 558.75 g/mol |
| Exact Mass | 558.38 |
| IUPAC Name | 4,12,20-trihydroxy-3,5,8,11,13,16,19,21,24-nonamethyl-1,9,17-trioxacyclotetracosane-2,10,18-trione |
| SMILES | CC1CCC(C)C(O)C(C)C(=O)OC(C)CCC(C)C(O)C(C)C(=O)OC(C)CCC(C)C(O)C(C)C(=O)O1 |
| InChI | InChI=1S/C30H54O9/c1-16-10-13-19(4)37-29(35)23(8)26(32)18(3)12-15-21(6)39-30(36)24(9)27(33)17(2)11-14-20(5)38-28(34)22(7)25(16)31/h16-27,31-33H,10-15H2,1-9H3 |
| InChIKey | QBBIQHYFLRPBKF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.75 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|