C24H46N4O7 — CID 10674386
1,15,18,18,24,24-hexamethyl-2,5,8,11,14-pentaoxa-17,20,23,26-tetrazabicyclo[13.6.6]heptacosane-16,22-dione (PubChem CID 10674386) has the molecular formula C24H46N4O7 and a molecular weight of 502.65 g/mol. Its IUPAC name is 1,15,18,18,24,24-hexamethyl-2,5,8,11,14-pentaoxa-17,20,23,26-tetrazabicyclo[13.6.6]heptacosane-16,22-dione.
| Compound Name | 1,15,18,18,24,24-hexamethyl-2,5,8,11,14-pentaoxa-17,20,23,26-tetrazabicyclo[13.6.6]heptacosane-16,22-dione |
|---|---|
| PubChem CID | 10674386 |
| Molecular Formula | C24H46N4O7 |
| Molecular Weight | 502.65 g/mol |
| Exact Mass | 502.34 |
| IUPAC Name | 1,15,18,18,24,24-hexamethyl-2,5,8,11,14-pentaoxa-17,20,23,26-tetrazabicyclo[13.6.6]heptacosane-16,22-dione |
| SMILES | CC1(C)CNCC2(C)OCCOCCOCCOCCOC(C)(CNCC(C)(C)NC2=O)C(=O)N1 |
| InChI | InChI=1S/C24H46N4O7/c1-21(2)15-25-17-24(6)20(30)28-22(3,4)16-26-18-23(5,19(29)27-21)34-13-11-32-9-7-31-8-10-33-12-14-35-24/h25-26H,7-18H2,1-6H3,(H,27,29)(H,28,30) |
| InChIKey | NYUHEAKMCUHYSD-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 128.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.65 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|