C16H30N2O3 — CID 106744119
2-methyl-1-(octan-2-ylcarbamoyl)piperidine-4-carboxylic acid (PubChem CID 106744119) has the molecular formula C16H30N2O3 and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-methyl-1-(octan-2-ylcarbamoyl)piperidine-4-carboxylic acid.
| Compound Name | 2-methyl-1-(octan-2-ylcarbamoyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 106744119 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 2-methyl-1-(octan-2-ylcarbamoyl)piperidine-4-carboxylic acid |
| SMILES | CCCCCCC(C)NC(=O)N1CCC(C(=O)O)CC1C |
| InChI | InChI=1S/C16H30N2O3/c1-4-5-6-7-8-12(2)17-16(21)18-10-9-14(15(19)20)11-13(18)3/h12-14H,4-11H2,1-3H3,(H,17,21)(H,19,20) |
| InChIKey | QBJQDUBQOFEMFD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|