C23H34F7N3O5 — CID 10674492
tert-butyl N-[(2S)-1-[(2S)-2-[(5,5,6,6,7,7,7-heptafluoro-2-methyl-4-oxoheptan-3-yl)carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 10674492) has the molecular formula C23H34F7N3O5 and a molecular weight of 565.53 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[(2S)-2-[(5,5,6,6,7,7,7-heptafluoro-2-methyl-4-oxoheptan-3-yl)carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[(2S)-2-[(5,5,6,6,7,7,7-heptafluoro-2-methyl-4-oxoheptan-3-yl)carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 10674492 |
| Molecular Formula | C23H34F7N3O5 |
| Molecular Weight | 565.53 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | tert-butyl N-[(2S)-1-[(2S)-2-[(5,5,6,6,7,7,7-heptafluoro-2-methyl-4-oxoheptan-3-yl)carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)C(NC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)C)C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H34F7N3O5/c1-11(2)14(16(34)21(24,25)22(26,27)23(28,29)30)31-17(35)13-9-8-10-33(13)18(36)15(12(3)4)32-19(37)38-20(5,6)7/h11-15H,8-10H2,1-7H3,(H,31,35)(H,32,37)/t13-,14?,15-/m0/s1 |
| InChIKey | VQOMTGYZRICFQK-LWEDLAQUSA-N |
| XLogP | 4.07 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|