C36H44O4Si — CID 10674554
(2S,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-bis(phenylmethoxy)pentan-3-ol (PubChem CID 10674554) has the molecular formula C36H44O4Si and a molecular weight of 568.83 g/mol. Its IUPAC name is (2S,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-bis(phenylmethoxy)pentan-3-ol.
| Compound Name | (2S,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-bis(phenylmethoxy)pentan-3-ol |
|---|---|
| PubChem CID | 10674554 |
| Molecular Formula | C36H44O4Si |
| Molecular Weight | 568.83 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | (2S,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-bis(phenylmethoxy)pentan-3-ol |
| SMILES | CC[C@@](O)(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C36H44O4Si/c1-5-36(37,34(39-27-31-20-12-7-13-21-31)28-38-26-30-18-10-6-11-19-30)29-40-41(35(2,3)4,32-22-14-8-15-23-32)33-24-16-9-17-25-33/h6-25,34,37H,5,26-29H2,1-4H3/t34-,36+/m0/s1 |
| InChIKey | NYVHLCODFARPLX-PUDHBBIYSA-N |
| XLogP | 6.51 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.83 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|